C20H31FIN5O2 — CID 111570612
1-[[[N-ethyl-N'-[2-(4-fluoroanilino)-2-oxoethyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide (PubChem CID 111570612) has the molecular formula C20H31FIN5O2 and a molecular weight of 519.40 g/mol. Its IUPAC name is 1-[[[N-ethyl-N'-[2-(4-fluoroanilino)-2-oxoethyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide.
| Compound Name | 1-[[[N-ethyl-N'-[2-(4-fluoroanilino)-2-oxoethyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111570612 |
| Molecular Formula | C20H31FIN5O2 |
| Molecular Weight | 519.40 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | 1-[[[N-ethyl-N'-[2-(4-fluoroanilino)-2-oxoethyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(F)cc1)NCC1(C(=O)N(C)C)CCCC1.I |
| InChI | InChI=1S/C20H30FN5O2.HI/c1-4-22-19(23-13-17(27)25-16-9-7-15(21)8-10-16)24-14-20(11-5-6-12-20)18(28)26(2)3;/h7-10H,4-6,11-14H2,1-3H3,(H,25,27)(H2,22,23,24);1H |
| InChIKey | NJSKHKQSRMOTSF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|