C20H32FIN4O — CID 111571288
1-[[[N-ethyl-N'-[(4-fluoro-3-methylphenyl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide (PubChem CID 111571288) has the molecular formula C20H32FIN4O and a molecular weight of 490.41 g/mol. Its IUPAC name is 1-[[[N-ethyl-N'-[(4-fluoro-3-methylphenyl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide.
| Compound Name | 1-[[[N-ethyl-N'-[(4-fluoro-3-methylphenyl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111571288 |
| Molecular Formula | C20H32FIN4O |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 1-[[[N-ethyl-N'-[(4-fluoro-3-methylphenyl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(F)c(C)c1)NCC1(C(=O)N(C)C)CCCC1.I |
| InChI | InChI=1S/C20H31FN4O.HI/c1-5-22-19(23-13-16-8-9-17(21)15(2)12-16)24-14-20(10-6-7-11-20)18(26)25(3)4;/h8-9,12H,5-7,10-11,13-14H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | QHPYRXQTWPQLAE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|