C20H29F3N4O — CID 111572011
1-[[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide (PubChem CID 111572011) has the molecular formula C20H29F3N4O and a molecular weight of 398.47 g/mol. Its IUPAC name is 1-[[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide.
| Compound Name | 1-[[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 111572011 |
| Molecular Formula | C20H29F3N4O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 1-[[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
| SMILES | CCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCC1(C(=O)N(C)C)CCCC1 |
| InChI | InChI=1S/C20H29F3N4O/c1-4-24-18(25-13-15-8-7-9-16(12-15)20(21,22)23)26-14-19(10-5-6-11-19)17(28)27(2)3/h7-9,12H,4-6,10-11,13-14H2,1-3H3,(H2,24,25,26) |
| InChIKey | UBEHPYZYFCHPSU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|