C21H31F3N4O2 — CID 111569687
1-[[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide (PubChem CID 111569687) has the molecular formula C21H31F3N4O2 and a molecular weight of 428.50 g/mol. Its IUPAC name is 1-[[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide.
| Compound Name | 1-[[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 111569687 |
| Molecular Formula | C21H31F3N4O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 1-[[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
| SMILES | CCN/C(=N\Cc1ccc(OCC(F)(F)F)cc1)NCC1(C(=O)N(C)C)CCCC1 |
| InChI | InChI=1S/C21H31F3N4O2/c1-4-25-19(27-14-20(11-5-6-12-20)18(29)28(2)3)26-13-16-7-9-17(10-8-16)30-15-21(22,23)24/h7-10H,4-6,11-15H2,1-3H3,(H2,25,26,27) |
| InChIKey | PXEGTDDECFCFSC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|