C23H37N5OS — CID 111570535
1-[[[N-ethyl-N'-[(4-thiomorpholin-4-ylphenyl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide (PubChem CID 111570535) has the molecular formula C23H37N5OS and a molecular weight of 431.65 g/mol. Its IUPAC name is 1-[[[N-ethyl-N'-[(4-thiomorpholin-4-ylphenyl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide.
| Compound Name | 1-[[[N-ethyl-N'-[(4-thiomorpholin-4-ylphenyl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 111570535 |
| Molecular Formula | C23H37N5OS |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | 1-[[[N-ethyl-N'-[(4-thiomorpholin-4-ylphenyl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCSCC2)cc1)NCC1(C(=O)N(C)C)CCCC1 |
| InChI | InChI=1S/C23H37N5OS/c1-4-24-22(26-18-23(11-5-6-12-23)21(29)27(2)3)25-17-19-7-9-20(10-8-19)28-13-15-30-16-14-28/h7-10H,4-6,11-18H2,1-3H3,(H2,24,25,26) |
| InChIKey | NODLQWJWILIXOD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|