C23H37IN6O2 — CID 111570170
1-[[[N-ethyl-N'-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide (PubChem CID 111570170) has the molecular formula C23H37IN6O2 and a molecular weight of 556.49 g/mol. Its IUPAC name is 1-[[[N-ethyl-N'-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide.
| Compound Name | 1-[[[N-ethyl-N'-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111570170 |
| Molecular Formula | C23H37IN6O2 |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | 1-[[[N-ethyl-N'-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCNC(=O)C2)cc1)NCC1(C(=O)N(C)C)CCCC1.I |
| InChI | InChI=1S/C23H36N6O2.HI/c1-4-24-22(27-17-23(11-5-6-12-23)21(31)28(2)3)26-15-18-7-9-19(10-8-18)29-14-13-25-20(30)16-29;/h7-10H,4-6,11-17H2,1-3H3,(H,25,30)(H2,24,26,27);1H |
| InChIKey | NGIYGDPSGKNNDF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|