C23H29F3IN5O — CID 111295616
1-ethyl-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide (PubChem CID 111295616) has the molecular formula C23H29F3IN5O and a molecular weight of 575.42 g/mol. Its IUPAC name is 1-ethyl-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111295616 |
| Molecular Formula | C23H29F3IN5O |
| Molecular Weight | 575.42 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | 1-ethyl-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCNC(=O)C2)cc1)NCCc1ccc(C(F)(F)F)cc1.I |
| InChI | InChI=1S/C23H28F3N5O.HI/c1-2-27-22(29-12-11-17-3-7-19(8-4-17)23(24,25)26)30-15-18-5-9-20(10-6-18)31-14-13-28-21(32)16-31;/h3-10H,2,11-16H2,1H3,(H,28,32)(H2,27,29,30);1H |
| InChIKey | PZWGCPOVKXIVMC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|