C25H36IN5O2 — CID 111403108
1-ethyl-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-[3-(1-phenylethoxy)propyl]guanidine;hydroiodide (PubChem CID 111403108) has the molecular formula C25H36IN5O2 and a molecular weight of 565.50 g/mol. Its IUPAC name is 1-ethyl-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-[3-(1-phenylethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-[3-(1-phenylethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111403108 |
| Molecular Formula | C25H36IN5O2 |
| Molecular Weight | 565.50 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | 1-ethyl-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-[3-(1-phenylethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCNC(=O)C2)cc1)NCCCOC(C)c1ccccc1.I |
| InChI | InChI=1S/C25H35N5O2.HI/c1-3-26-25(28-14-7-17-32-20(2)22-8-5-4-6-9-22)29-18-21-10-12-23(13-11-21)30-16-15-27-24(31)19-30;/h4-6,8-13,20H,3,7,14-19H2,1-2H3,(H,27,31)(H2,26,28,29);1H |
| InChIKey | ZGATVUDPDPZVNI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|