C25H32IN7O — CID 111863667
1-ethyl-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111863667) has the molecular formula C25H32IN7O and a molecular weight of 573.48 g/mol. Its IUPAC name is 1-ethyl-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111863667 |
| Molecular Formula | C25H32IN7O |
| Molecular Weight | 573.48 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | 1-ethyl-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCNC(=O)C2)cc1)NCCc1ccc(-n2cccn2)cc1.I |
| InChI | InChI=1S/C25H31N7O.HI/c1-2-26-25(28-14-12-20-4-10-23(11-5-20)32-16-3-13-30-32)29-18-21-6-8-22(9-7-21)31-17-15-27-24(33)19-31;/h3-11,13,16H,2,12,14-15,17-19H2,1H3,(H,27,33)(H2,26,28,29);1H |
| InChIKey | LDUFRMDXTKEODJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|