C25H33IN6O — CID 111864489
N-[4-[[[ethylamino-[2-(4-pyrazol-1-ylphenyl)ethylamino]methylidene]amino]methyl]phenyl]butanamide;hydroiodide (PubChem CID 111864489) has the molecular formula C25H33IN6O and a molecular weight of 560.48 g/mol. Its IUPAC name is N-[4-[[[ethylamino-[2-(4-pyrazol-1-ylphenyl)ethylamino]methylidene]amino]methyl]phenyl]butanamide;hydroiodide.
| Compound Name | N-[4-[[[ethylamino-[2-(4-pyrazol-1-ylphenyl)ethylamino]methylidene]amino]methyl]phenyl]butanamide;hydroiodide |
|---|---|
| PubChem CID | 111864489 |
| Molecular Formula | C25H33IN6O |
| Molecular Weight | 560.48 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | N-[4-[[[ethylamino-[2-(4-pyrazol-1-ylphenyl)ethylamino]methylidene]amino]methyl]phenyl]butanamide;hydroiodide |
| SMILES | CCCC(=O)Nc1ccc(C/N=C(\NCC)NCCc2ccc(-n3cccn3)cc2)cc1.I |
| InChI | InChI=1S/C25H32N6O.HI/c1-3-6-24(32)30-22-11-7-21(8-12-22)19-28-25(26-4-2)27-17-15-20-9-13-23(14-10-20)31-18-5-16-29-31;/h5,7-14,16,18H,3-4,6,15,17,19H2,1-2H3,(H,30,32)(H2,26,27,28);1H |
| InChIKey | NXLWDEFZXKGEKI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|