C24H31N5O3 — CID 111864184
1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine (PubChem CID 111864184) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111864184 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC)c1OC)NCCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C24H31N5O3/c1-5-25-24(27-17-19-9-12-21(30-2)23(32-4)22(19)31-3)26-15-13-18-7-10-20(11-8-18)29-16-6-14-28-29/h6-12,14,16H,5,13,15,17H2,1-4H3,(H2,25,26,27) |
| InChIKey | SFAYWWOAMVBFHJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|