C21H29N3O3 — CID 110952276
2-benzyl-1-ethyl-3-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine (PubChem CID 110952276) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 2-benzyl-1-ethyl-3-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine.
| Compound Name | 2-benzyl-1-ethyl-3-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 110952276 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 2-benzyl-1-ethyl-3-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1)NCCc1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C21H29N3O3/c1-5-22-21(24-15-16-9-7-6-8-10-16)23-14-13-17-11-12-18(25-2)20(27-4)19(17)26-3/h6-12H,5,13-15H2,1-4H3,(H2,22,23,24) |
| InChIKey | HWQRZFCEAREUFP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|