C25H34N8 — CID 111864496
1-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine (PubChem CID 111864496) has the molecular formula C25H34N8 and a molecular weight of 446.60 g/mol. Its IUPAC name is 1-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111864496 |
| Molecular Formula | C25H34N8 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | 1-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCN(C)CC1)NCCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C25H34N8/c1-3-26-25(28-14-11-21-7-9-23(10-8-21)33-15-5-13-30-33)29-20-22-6-4-12-27-24(22)32-18-16-31(2)17-19-32/h4-10,12-13,15H,3,11,14,16-20H2,1-2H3,(H2,26,28,29) |
| InChIKey | GKFDQLINTOKODZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 73.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|