C17H29IN6 — CID 110980600
1-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-prop-2-enylguanidine;hydroiodide (PubChem CID 110980600) has the molecular formula C17H29IN6 and a molecular weight of 444.37 g/mol. Its IUPAC name is 1-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110980600 |
| Molecular Formula | C17H29IN6 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 1-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N/Cc1cccnc1N1CCN(C)CC1)NCC.I |
| InChI | InChI=1S/C17H28N6.HI/c1-4-8-20-17(18-5-2)21-14-15-7-6-9-19-16(15)23-12-10-22(3)11-13-23;/h4,6-7,9H,1,5,8,10-14H2,2-3H3,(H2,18,20,21);1H |
| InChIKey | AGARTSQZCTXMLF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|