C23H42IN7 — CID 111387558
1-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[3-(4-methylpiperidin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111387558) has the molecular formula C23H42IN7 and a molecular weight of 543.54 g/mol. Its IUPAC name is 1-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[3-(4-methylpiperidin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[3-(4-methylpiperidin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111387558 |
| Molecular Formula | C23H42IN7 |
| Molecular Weight | 543.54 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | 1-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[3-(4-methylpiperidin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCN(C)CC1)NCCCN1CCC(C)CC1.I |
| InChI | InChI=1S/C23H41N7.HI/c1-4-24-23(26-11-6-12-29-13-8-20(2)9-14-29)27-19-21-7-5-10-25-22(21)30-17-15-28(3)16-18-30;/h5,7,10,20H,4,6,8-9,11-19H2,1-3H3,(H2,24,26,27);1H |
| InChIKey | CDWOYCJXBDIMFP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 59.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.54 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|