C26H39N7 — CID 110985910
1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine (PubChem CID 110985910) has the molecular formula C26H39N7 and a molecular weight of 449.65 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 110985910 |
| Molecular Formula | C26H39N7 |
| Molecular Weight | 449.65 g/mol |
| Exact Mass | 449.33 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCN(C)CC1)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H39N7/c1-3-27-26(30-24-11-14-32(15-12-24)21-22-8-5-4-6-9-22)29-20-23-10-7-13-28-25(23)33-18-16-31(2)17-19-33/h4-10,13,24H,3,11-12,14-21H2,1-2H3,(H2,27,29,30) |
| InChIKey | YGUSQVIKTSULMG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 59.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.65 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|