C22H29FN4 — CID 110987540
1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[(3-fluorophenyl)methyl]guanidine (PubChem CID 110987540) has the molecular formula C22H29FN4 and a molecular weight of 368.50 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[(3-fluorophenyl)methyl]guanidine.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[(3-fluorophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 110987540 |
| Molecular Formula | C22H29FN4 |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[(3-fluorophenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(F)c1)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H29FN4/c1-2-24-22(25-16-19-9-6-10-20(23)15-19)26-21-11-13-27(14-12-21)17-18-7-4-3-5-8-18/h3-10,15,21H,2,11-14,16-17H2,1H3,(H2,24,25,26) |
| InChIKey | GXYIUIHNFBHVEC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|