C24H34FN5 — CID 110985956
1-(1-benzylpiperidin-4-yl)-2-[[4-(dimethylamino)-3-fluorophenyl]methyl]-3-ethylguanidine (PubChem CID 110985956) has the molecular formula C24H34FN5 and a molecular weight of 411.57 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-2-[[4-(dimethylamino)-3-fluorophenyl]methyl]-3-ethylguanidine.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-2-[[4-(dimethylamino)-3-fluorophenyl]methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 110985956 |
| Molecular Formula | C24H34FN5 |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-2-[[4-(dimethylamino)-3-fluorophenyl]methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(N(C)C)c(F)c1)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H34FN5/c1-4-26-24(27-17-20-10-11-23(29(2)3)22(25)16-20)28-21-12-14-30(15-13-21)18-19-8-6-5-7-9-19/h5-11,16,21H,4,12-15,17-18H2,1-3H3,(H2,26,27,28) |
| InChIKey | VGNNDOMHYBSAFY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|