C22H38FN5 — CID 111833433
2-[[4-(diethylamino)-3-fluorophenyl]methyl]-1-ethyl-3-(1-propan-2-ylpiperidin-4-yl)guanidine (PubChem CID 111833433) has the molecular formula C22H38FN5 and a molecular weight of 391.58 g/mol. Its IUPAC name is 2-[[4-(diethylamino)-3-fluorophenyl]methyl]-1-ethyl-3-(1-propan-2-ylpiperidin-4-yl)guanidine.
| Compound Name | 2-[[4-(diethylamino)-3-fluorophenyl]methyl]-1-ethyl-3-(1-propan-2-ylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 111833433 |
| Molecular Formula | C22H38FN5 |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.31 |
| IUPAC Name | 2-[[4-(diethylamino)-3-fluorophenyl]methyl]-1-ethyl-3-(1-propan-2-ylpiperidin-4-yl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N(CC)CC)c(F)c1)NC1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C22H38FN5/c1-6-24-22(26-19-11-13-28(14-12-19)17(4)5)25-16-18-9-10-21(20(23)15-18)27(7-2)8-3/h9-10,15,17,19H,6-8,11-14,16H2,1-5H3,(H2,24,25,26) |
| InChIKey | ZFNMWUHRUBVEPB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|