C22H33FN6 — CID 111319060
1-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine (PubChem CID 111319060) has the molecular formula C22H33FN6 and a molecular weight of 400.55 g/mol. Its IUPAC name is 1-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine.
| Compound Name | 1-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 111319060 |
| Molecular Formula | C22H33FN6 |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | 1-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(-n2ccnc2C)c(F)c1)NC1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C22H33FN6/c1-5-24-22(27-19-8-11-28(12-9-19)16(2)3)26-15-18-6-7-21(20(23)14-18)29-13-10-25-17(29)4/h6-7,10,13-14,16,19H,5,8-9,11-12,15H2,1-4H3,(H2,24,26,27) |
| InChIKey | QCOBJNFCVVGJTP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|