C20H28FIN6O — CID 111927266
N-[2-[[N-ethyl-N'-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide (PubChem CID 111927266) has the molecular formula C20H28FIN6O and a molecular weight of 514.39 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 111927266 |
| Molecular Formula | C20H28FIN6O |
| Molecular Weight | 514.39 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(-n2ccnc2C)c(F)c1)NCCNC(=O)C1CC1.I |
| InChI | InChI=1S/C20H27FN6O.HI/c1-3-22-20(25-9-8-24-19(28)16-5-6-16)26-13-15-4-7-18(17(21)12-15)27-11-10-23-14(27)2;/h4,7,10-12,16H,3,5-6,8-9,13H2,1-2H3,(H,24,28)(H2,22,25,26);1H |
| InChIKey | YOAQBFSFWJSZGE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|