C20H31FIN5O2 — CID 111927881
N-[2-[[N-ethyl-N'-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide (PubChem CID 111927881) has the molecular formula C20H31FIN5O2 and a molecular weight of 519.40 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 111927881 |
| Molecular Formula | C20H31FIN5O2 |
| Molecular Weight | 519.40 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCOCC2)c(F)c1)NCCNC(=O)C1CC1.I |
| InChI | InChI=1S/C20H30FN5O2.HI/c1-2-22-20(24-8-7-23-19(27)16-4-5-16)25-14-15-3-6-18(17(21)13-15)26-9-11-28-12-10-26;/h3,6,13,16H,2,4-5,7-12,14H2,1H3,(H,23,27)(H2,22,24,25);1H |
| InChIKey | VHQRNJRFKKMYNL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|