C24H32FN5O2 — CID 111872999
4-[[[N-ethyl-N'-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylbenzamide (PubChem CID 111872999) has the molecular formula C24H32FN5O2 and a molecular weight of 441.55 g/mol. Its IUPAC name is 4-[[[N-ethyl-N'-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[[[N-ethyl-N'-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111872999 |
| Molecular Formula | C24H32FN5O2 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | 4-[[[N-ethyl-N'-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylbenzamide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCOCC2)c(F)c1)NCc1ccc(C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C24H32FN5O2/c1-4-26-24(27-16-18-5-8-20(9-6-18)23(31)29(2)3)28-17-19-7-10-22(21(25)15-19)30-11-13-32-14-12-30/h5-10,15H,4,11-14,16-17H2,1-3H3,(H2,26,27,28) |
| InChIKey | MOAMXJXFKYJJEX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|