C21H27F2IN4O — CID 111266686
1-ethyl-2-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-3-[(2-fluorophenyl)methyl]guanidine;hydroiodide (PubChem CID 111266686) has the molecular formula C21H27F2IN4O and a molecular weight of 516.37 g/mol. Its IUPAC name is 1-ethyl-2-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-3-[(2-fluorophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-3-[(2-fluorophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111266686 |
| Molecular Formula | C21H27F2IN4O |
| Molecular Weight | 516.37 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 1-ethyl-2-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-3-[(2-fluorophenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCOCC2)c(F)c1)NCc1ccccc1F.I |
| InChI | InChI=1S/C21H26F2N4O.HI/c1-2-24-21(26-15-17-5-3-4-6-18(17)22)25-14-16-7-8-20(19(23)13-16)27-9-11-28-12-10-27;/h3-8,13H,2,9-12,14-15H2,1H3,(H2,24,25,26);1H |
| InChIKey | REDSOTNLZAZMNM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|