C21H32FIN6O — CID 110971544
1-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 110971544) has the molecular formula C21H32FIN6O and a molecular weight of 530.43 g/mol. Its IUPAC name is 1-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110971544 |
| Molecular Formula | C21H32FIN6O |
| Molecular Weight | 530.43 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | 1-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(-n2ccnc2C)c(F)c1)NCCCN1CCOCC1.I |
| InChI | InChI=1S/C21H31FN6O.HI/c1-3-23-21(25-7-4-9-27-11-13-29-14-12-27)26-16-18-5-6-20(19(22)15-18)28-10-8-24-17(28)2;/h5-6,8,10,15H,3-4,7,9,11-14,16H2,1-2H3,(H2,23,25,26);1H |
| InChIKey | GYNCMBUJNUPOPM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|