C23H35FN6O — CID 111368545
1-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine (PubChem CID 111368545) has the molecular formula C23H35FN6O and a molecular weight of 430.57 g/mol. Its IUPAC name is 1-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine.
| Compound Name | 1-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111368545 |
| Molecular Formula | C23H35FN6O |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | 1-ethyl-2-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(-n2ccnc2C)c(F)c1)NCC1CN(CC(C)C)CCO1 |
| InChI | InChI=1S/C23H35FN6O/c1-5-25-23(28-14-20-16-29(10-11-31-20)15-17(2)3)27-13-19-6-7-22(21(24)12-19)30-9-8-26-18(30)4/h6-9,12,17,20H,5,10-11,13-16H2,1-4H3,(H2,25,27,28) |
| InChIKey | CFIPFMNHKCSFAV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|