C20H38N6O — CID 111775850
1-ethyl-2-[[1-(2-methylpropyl)imidazol-2-yl]methyl]-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine (PubChem CID 111775850) has the molecular formula C20H38N6O and a molecular weight of 378.57 g/mol. Its IUPAC name is 1-ethyl-2-[[1-(2-methylpropyl)imidazol-2-yl]methyl]-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine.
| Compound Name | 1-ethyl-2-[[1-(2-methylpropyl)imidazol-2-yl]methyl]-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111775850 |
| Molecular Formula | C20H38N6O |
| Molecular Weight | 378.57 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | 1-ethyl-2-[[1-(2-methylpropyl)imidazol-2-yl]methyl]-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nccn1CC(C)C)NCC1CN(CC(C)C)CCO1 |
| InChI | InChI=1S/C20H38N6O/c1-6-21-20(24-12-19-22-7-8-26(19)14-17(4)5)23-11-18-15-25(9-10-27-18)13-16(2)3/h7-8,16-18H,6,9-15H2,1-5H3,(H2,21,23,24) |
| InChIKey | CDELSPAKSXRMDV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.57 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|