C16H31IN6O2 — CID 111601875
1-ethyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111601875) has the molecular formula C16H31IN6O2 and a molecular weight of 466.37 g/mol. Its IUPAC name is 1-ethyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111601875 |
| Molecular Formula | C16H31IN6O2 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 1-ethyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1noc(C)n1)NCC1CN(CC(C)C)CCO1.I |
| InChI | InChI=1S/C16H30N6O2.HI/c1-5-17-16(19-9-15-20-13(4)24-21-15)18-8-14-11-22(6-7-23-14)10-12(2)3;/h12,14H,5-11H2,1-4H3,(H2,17,18,19);1H |
| InChIKey | NTGHUQPIBGETRJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 87.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|