C21H36N6O — CID 111318386
1-ethyl-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine (PubChem CID 111318386) has the molecular formula C21H36N6O and a molecular weight of 388.56 g/mol. Its IUPAC name is 1-ethyl-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine.
| Compound Name | 1-ethyl-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 111318386 |
| Molecular Formula | C21H36N6O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | 1-ethyl-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCOCC1)NC1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C21H36N6O/c1-4-22-21(25-19-7-10-26(11-8-19)17(2)3)24-16-18-6-5-9-23-20(18)27-12-14-28-15-13-27/h5-6,9,17,19H,4,7-8,10-16H2,1-3H3,(H2,22,24,25) |
| InChIKey | QFSRCHQPGUSCBB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 65.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|