C19H31N5OS — CID 111528843
1-ethyl-3-(3-methylsulfanylcyclopentyl)-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine (PubChem CID 111528843) has the molecular formula C19H31N5OS and a molecular weight of 377.56 g/mol. Its IUPAC name is 1-ethyl-3-(3-methylsulfanylcyclopentyl)-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-(3-methylsulfanylcyclopentyl)-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111528843 |
| Molecular Formula | C19H31N5OS |
| Molecular Weight | 377.56 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 1-ethyl-3-(3-methylsulfanylcyclopentyl)-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCOCC1)NC1CCC(SC)C1 |
| InChI | InChI=1S/C19H31N5OS/c1-3-20-19(23-16-6-7-17(13-16)26-2)22-14-15-5-4-8-21-18(15)24-9-11-25-12-10-24/h4-5,8,16-17H,3,6-7,9-14H2,1-2H3,(H2,20,22,23) |
| InChIKey | BJEWJWCWKMRVGD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.56 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|