C27H33N5O — CID 111357122
1-(2,2-diphenylethyl)-3-ethyl-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine (PubChem CID 111357122) has the molecular formula C27H33N5O and a molecular weight of 443.60 g/mol. Its IUPAC name is 1-(2,2-diphenylethyl)-3-ethyl-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine.
| Compound Name | 1-(2,2-diphenylethyl)-3-ethyl-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111357122 |
| Molecular Formula | C27H33N5O |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | 1-(2,2-diphenylethyl)-3-ethyl-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCOCC1)NCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H33N5O/c1-2-28-27(30-20-24-14-9-15-29-26(24)32-16-18-33-19-17-32)31-21-25(22-10-5-3-6-11-22)23-12-7-4-8-13-23/h3-15,25H,2,16-21H2,1H3,(H2,28,30,31) |
| InChIKey | SDNBUIDCVPVEHJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|