C22H31FIN5OS — CID 111311321
1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 111311321) has the molecular formula C22H31FIN5OS and a molecular weight of 559.49 g/mol. Its IUPAC name is 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111311321 |
| Molecular Formula | C22H31FIN5OS |
| Molecular Weight | 559.49 g/mol |
| Exact Mass | 559.13 |
| IUPAC Name | 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCOCC1)NCCCSc1ccc(F)cc1.I |
| InChI | InChI=1S/C22H30FN5OS.HI/c1-2-24-22(26-11-4-16-30-20-8-6-19(23)7-9-20)27-17-18-5-3-10-25-21(18)28-12-14-29-15-13-28;/h3,5-10H,2,4,11-17H2,1H3,(H2,24,26,27);1H |
| InChIKey | XARJVDPBCDBYMW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|