C21H25F4N5O — CID 111889359
1-ethyl-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine (PubChem CID 111889359) has the molecular formula C21H25F4N5O and a molecular weight of 439.46 g/mol. Its IUPAC name is 1-ethyl-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111889359 |
| Molecular Formula | C21H25F4N5O |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 1-ethyl-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCOCC1)NCc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C21H25F4N5O/c1-2-26-20(28-13-15-5-6-17(22)12-18(15)21(23,24)25)29-14-16-4-3-7-27-19(16)30-8-10-31-11-9-30/h3-7,12H,2,8-11,13-14H2,1H3,(H2,26,28,29) |
| InChIKey | GKMTUJFTXGAMOY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|