C21H26F4IN5 — CID 111889300
1-ethyl-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 111889300) has the molecular formula C21H26F4IN5 and a molecular weight of 551.37 g/mol. Its IUPAC name is 1-ethyl-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111889300 |
| Molecular Formula | C21H26F4IN5 |
| Molecular Weight | 551.37 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | 1-ethyl-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnc(N2CCCC2)c1)NCc1ccc(F)cc1C(F)(F)F.I |
| InChI | InChI=1S/C21H25F4N5.HI/c1-2-26-20(29-14-16-5-6-17(22)12-18(16)21(23,24)25)28-13-15-7-8-27-19(11-15)30-9-3-4-10-30;/h5-8,11-12H,2-4,9-10,13-14H2,1H3,(H2,26,28,29);1H |
| InChIKey | VIFLMWWXXTWTQK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|