C20H27ClIN5 — CID 111176791
2-[(3-chlorophenyl)methyl]-1-ethyl-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 111176791) has the molecular formula C20H27ClIN5 and a molecular weight of 499.83 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-1-ethyl-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[(3-chlorophenyl)methyl]-1-ethyl-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111176791 |
| Molecular Formula | C20H27ClIN5 |
| Molecular Weight | 499.83 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-1-ethyl-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(Cl)c1)NCc1ccnc(N2CCCC2)c1.I |
| InChI | InChI=1S/C20H26ClN5.HI/c1-2-22-20(24-14-16-6-5-7-18(21)12-16)25-15-17-8-9-23-19(13-17)26-10-3-4-11-26;/h5-9,12-13H,2-4,10-11,14-15H2,1H3,(H2,22,24,25);1H |
| InChIKey | AUDXOOFCWLWQSU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.83 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|