C21H28Cl2IN5O — CID 109492532
1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 109492532) has the molecular formula C21H28Cl2IN5O and a molecular weight of 564.30 g/mol. Its IUPAC name is 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109492532 |
| Molecular Formula | C21H28Cl2IN5O |
| Molecular Weight | 564.30 g/mol |
| Exact Mass | 563.07 |
| IUPAC Name | 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnc(N2CCCC2)c1)NCC(O)c1cc(Cl)cc(Cl)c1.I |
| InChI | InChI=1S/C21H27Cl2N5O.HI/c1-2-24-21(27-14-19(29)16-10-17(22)12-18(23)11-16)26-13-15-5-6-25-20(9-15)28-7-3-4-8-28;/h5-6,9-12,19,29H,2-4,7-8,13-14H2,1H3,(H2,24,26,27);1H |
| InChIKey | QZHMYUCTTKUBSU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.30 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|