C23H31N5O2 — CID 111998711
1-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-2-(1,3-benzodioxol-5-ylmethyl)-3-ethylguanidine (PubChem CID 111998711) has the molecular formula C23H31N5O2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-2-(1,3-benzodioxol-5-ylmethyl)-3-ethylguanidine.
| Compound Name | 1-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-2-(1,3-benzodioxol-5-ylmethyl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111998711 |
| Molecular Formula | C23H31N5O2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 1-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-2-(1,3-benzodioxol-5-ylmethyl)-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc2c(c1)OCO2)NCc1ccnc(N2CCCCCC2)c1 |
| InChI | InChI=1S/C23H31N5O2/c1-2-24-23(26-15-18-7-8-20-21(13-18)30-17-29-20)27-16-19-9-10-25-22(14-19)28-11-5-3-4-6-12-28/h7-10,13-14H,2-6,11-12,15-17H2,1H3,(H2,24,26,27) |
| InChIKey | SDATUIAFZGLQJU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|