C23H31ClN6 — CID 109463422
1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine (PubChem CID 109463422) has the molecular formula C23H31ClN6 and a molecular weight of 427.00 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine.
| Compound Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 109463422 |
| Molecular Formula | C23H31ClN6 |
| Molecular Weight | 427.00 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(N2CCCC2)c1)NC1CCN(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C23H31ClN6/c1-2-25-23(27-16-18-8-10-26-22(14-18)29-11-3-4-12-29)28-20-9-13-30(17-20)21-7-5-6-19(24)15-21/h5-8,10,14-15,20H,2-4,9,11-13,16-17H2,1H3,(H2,25,27,28) |
| InChIKey | RGRATWCBUYRBPA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.00 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|