C23H30ClN5O — CID 109462792
3-[[[[[1-(3-chlorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]methyl]-N-ethylbenzamide (PubChem CID 109462792) has the molecular formula C23H30ClN5O and a molecular weight of 427.98 g/mol. Its IUPAC name is 3-[[[[[1-(3-chlorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]methyl]-N-ethylbenzamide.
| Compound Name | 3-[[[[[1-(3-chlorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]methyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 109462792 |
| Molecular Formula | C23H30ClN5O |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 3-[[[[[1-(3-chlorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]methyl]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cccc(C/N=C(\NCC)NC2CCN(c3cccc(Cl)c3)C2)c1 |
| InChI | InChI=1S/C23H30ClN5O/c1-3-25-22(30)18-8-5-7-17(13-18)15-27-23(26-4-2)28-20-11-12-29(16-20)21-10-6-9-19(24)14-21/h5-10,13-14,20H,3-4,11-12,15-16H2,1-2H3,(H,25,30)(H2,26,27,28) |
| InChIKey | NTCKPFAPRUBAAP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|