C21H26ClN5O — CID 109463830
3-[[[[[1-(3-chlorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]methyl]benzamide (PubChem CID 109463830) has the molecular formula C21H26ClN5O and a molecular weight of 399.93 g/mol. Its IUPAC name is 3-[[[[[1-(3-chlorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]methyl]benzamide.
| Compound Name | 3-[[[[[1-(3-chlorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 109463830 |
| Molecular Formula | C21H26ClN5O |
| Molecular Weight | 399.93 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 3-[[[[[1-(3-chlorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]methyl]benzamide |
| SMILES | CCN/C(=N\Cc1cccc(C(N)=O)c1)NC1CCN(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C21H26ClN5O/c1-2-24-21(25-13-15-5-3-6-16(11-15)20(23)28)26-18-9-10-27(14-18)19-8-4-7-17(22)12-19/h3-8,11-12,18H,2,9-10,13-14H2,1H3,(H2,23,28)(H2,24,25,26) |
| InChIKey | OIIHGIHPUUNGTJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.93 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|