C19H26ClN5S — CID 109463788
1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-ethylguanidine (PubChem CID 109463788) has the molecular formula C19H26ClN5S and a molecular weight of 391.97 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-ethylguanidine.
| Compound Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 109463788 |
| Molecular Formula | C19H26ClN5S |
| Molecular Weight | 391.97 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1sc(C)nc1C)NC1CCN(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C19H26ClN5S/c1-4-21-19(22-11-18-13(2)23-14(3)26-18)24-16-8-9-25(12-16)17-7-5-6-15(20)10-17/h5-7,10,16H,4,8-9,11-12H2,1-3H3,(H2,21,22,24) |
| InChIKey | PYGRNKFTZYNEPZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.97 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|