C20H29ClN6O — CID 109463404
2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-ethylguanidine (PubChem CID 109463404) has the molecular formula C20H29ClN6O and a molecular weight of 404.95 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-ethylguanidine.
| Compound Name | 2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-ethylguanidine |
|---|---|
| PubChem CID | 109463404 |
| Molecular Formula | C20H29ClN6O |
| Molecular Weight | 404.95 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1noc(C(C)(C)C)n1)NC1CCN(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C20H29ClN6O/c1-5-22-19(23-12-17-25-18(28-26-17)20(2,3)4)24-15-9-10-27(13-15)16-8-6-7-14(21)11-16/h6-8,11,15H,5,9-10,12-13H2,1-4H3,(H2,22,23,24) |
| InChIKey | DVSKNEYPURTDAC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.95 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|