C17H27ClN4O — CID 109463818
1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(3-methoxypropyl)guanidine (PubChem CID 109463818) has the molecular formula C17H27ClN4O and a molecular weight of 338.88 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(3-methoxypropyl)guanidine.
| Compound Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(3-methoxypropyl)guanidine |
|---|---|
| PubChem CID | 109463818 |
| Molecular Formula | C17H27ClN4O |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(3-methoxypropyl)guanidine |
| SMILES | CCN/C(=N\CCCOC)NC1CCN(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C17H27ClN4O/c1-3-19-17(20-9-5-11-23-2)21-15-8-10-22(13-15)16-7-4-6-14(18)12-16/h4,6-7,12,15H,3,5,8-11,13H2,1-2H3,(H2,19,20,21) |
| InChIKey | UWILELIOGDJHEY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|