C18H29ClIN5O — CID 109462761
3-[[[[1-(3-chlorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]-N,N-dimethylpropanamide;hydroiodide (PubChem CID 109462761) has the molecular formula C18H29ClIN5O and a molecular weight of 493.82 g/mol. Its IUPAC name is 3-[[[[1-(3-chlorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]-N,N-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[[[1-(3-chlorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]-N,N-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 109462761 |
| Molecular Formula | C18H29ClIN5O |
| Molecular Weight | 493.82 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | 3-[[[[1-(3-chlorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]-N,N-dimethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)N(C)C)NC1CCN(c2cccc(Cl)c2)C1.I |
| InChI | InChI=1S/C18H28ClN5O.HI/c1-4-20-18(21-10-8-17(25)23(2)3)22-15-9-11-24(13-15)16-7-5-6-14(19)12-16;/h5-7,12,15H,4,8-11,13H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | WFBZHYPJPIYIQH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.82 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|