C19H31ClIN5O2S — CID 109463809
1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethylguanidine;hydroiodide (PubChem CID 109463809) has the molecular formula C19H31ClIN5O2S and a molecular weight of 555.91 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109463809 |
| Molecular Formula | C19H31ClIN5O2S |
| Molecular Weight | 555.91 g/mol |
| Exact Mass | 555.09 |
| IUPAC Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCN1CCS(=O)(=O)CC1)NC1CCN(c2cccc(Cl)c2)C1.I |
| InChI | InChI=1S/C19H30ClN5O2S.HI/c1-2-21-19(22-7-9-24-10-12-28(26,27)13-11-24)23-17-6-8-25(15-17)18-5-3-4-16(20)14-18;/h3-5,14,17H,2,6-13,15H2,1H3,(H2,21,22,23);1H |
| InChIKey | MQQDXBZHUHQZRG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.91 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|