C20H33N5O2S — CID 111924341
2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-[1-(4-methylphenyl)pyrrolidin-3-yl]guanidine (PubChem CID 111924341) has the molecular formula C20H33N5O2S and a molecular weight of 407.58 g/mol. Its IUPAC name is 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-[1-(4-methylphenyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-[1-(4-methylphenyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111924341 |
| Molecular Formula | C20H33N5O2S |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-[1-(4-methylphenyl)pyrrolidin-3-yl]guanidine |
| SMILES | CCN/C(=N\CCN1CCS(=O)(=O)CC1)NC1CCN(c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C20H33N5O2S/c1-3-21-20(22-9-11-24-12-14-28(26,27)15-13-24)23-18-8-10-25(16-18)19-6-4-17(2)5-7-19/h4-7,18H,3,8-16H2,1-2H3,(H2,21,22,23) |
| InChIKey | BIIJRUIIPILCML-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|