C22H35N5O — CID 111923737
N-cyclohexyl-2-[[ethylamino-[[1-(4-methylphenyl)pyrrolidin-3-yl]amino]methylidene]amino]acetamide (PubChem CID 111923737) has the molecular formula C22H35N5O and a molecular weight of 385.56 g/mol. Its IUPAC name is N-cyclohexyl-2-[[ethylamino-[[1-(4-methylphenyl)pyrrolidin-3-yl]amino]methylidene]amino]acetamide.
| Compound Name | N-cyclohexyl-2-[[ethylamino-[[1-(4-methylphenyl)pyrrolidin-3-yl]amino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111923737 |
| Molecular Formula | C22H35N5O |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | N-cyclohexyl-2-[[ethylamino-[[1-(4-methylphenyl)pyrrolidin-3-yl]amino]methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC1CCCCC1)NC1CCN(c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C22H35N5O/c1-3-23-22(24-15-21(28)25-18-7-5-4-6-8-18)26-19-13-14-27(16-19)20-11-9-17(2)10-12-20/h9-12,18-19H,3-8,13-16H2,1-2H3,(H,25,28)(H2,23,24,26) |
| InChIKey | DZBJGZYIUXIUHC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|