C19H35N5O3 — CID 111329714
ethyl 4-[[N'-[2-(cyclohexylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111329714) has the molecular formula C19H35N5O3 and a molecular weight of 381.52 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-(cyclohexylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[2-(cyclohexylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111329714 |
| Molecular Formula | C19H35N5O3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | ethyl 4-[[N'-[2-(cyclohexylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\CC(=O)NC1CCCCC1)NC1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C19H35N5O3/c1-3-20-18(21-14-17(25)22-15-8-6-5-7-9-15)23-16-10-12-24(13-11-16)19(26)27-4-2/h15-16H,3-14H2,1-2H3,(H,22,25)(H2,20,21,23) |
| InChIKey | QBMUFEVRAMVHFS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|