C14H25IN4O2 — CID 111330091
ethyl 4-[(N-ethyl-N'-prop-2-ynylcarbamimidoyl)amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111330091) has the molecular formula C14H25IN4O2 and a molecular weight of 408.28 g/mol. Its IUPAC name is ethyl 4-[(N-ethyl-N'-prop-2-ynylcarbamimidoyl)amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[(N-ethyl-N'-prop-2-ynylcarbamimidoyl)amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111330091 |
| Molecular Formula | C14H25IN4O2 |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | ethyl 4-[(N-ethyl-N'-prop-2-ynylcarbamimidoyl)amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | C#CC/N=C(\NCC)NC1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C14H24N4O2.HI/c1-4-9-16-13(15-5-2)17-12-7-10-18(11-8-12)14(19)20-6-3;/h1,12H,5-11H2,2-3H3,(H2,15,16,17);1H |
| InChIKey | IUMBWXKIZRWZIV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|