C16H32IN5O4S — CID 111329717
ethyl 4-[[N'-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111329717) has the molecular formula C16H32IN5O4S and a molecular weight of 517.43 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111329717 |
| Molecular Formula | C16H32IN5O4S |
| Molecular Weight | 517.43 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | ethyl 4-[[N'-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCN1CCCS1(=O)=O)NC1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C16H31N5O4S.HI/c1-3-17-15(18-8-12-21-9-5-13-26(21,23)24)19-14-6-10-20(11-7-14)16(22)25-4-2;/h14H,3-13H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | LVFBGDZFBITCAN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.43 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|